C36H41NO2 — CID 123962717
(8S,13S,14S)-13-methyl-1-[4-(4-phenylpiperidine-1-carbonyl)phenyl]-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 123962717) has the molecular formula C36H41NO2 and a molecular weight of 519.73 g/mol. Its IUPAC name is (8S,13S,14S)-13-methyl-1-[4-(4-phenylpiperidine-1-carbonyl)phenyl]-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,13S,14S)-13-methyl-1-[4-(4-phenylpiperidine-1-carbonyl)phenyl]-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 123962717 |
| Molecular Formula | C36H41NO2 |
| Molecular Weight | 519.73 g/mol |
| Exact Mass | 519.31 |
| IUPAC Name | (8S,13S,14S)-13-methyl-1-[4-(4-phenylpiperidine-1-carbonyl)phenyl]-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CCC3=CC(=O)CC(c4ccc(C(=O)N5CCC(c6ccccc6)CC5)cc4)C3=C1CC2 |
| InChI | InChI=1S/C36H41NO2/c1-36-18-5-8-33(36)30-14-13-28-22-29(38)23-32(34(28)31(30)15-19-36)26-9-11-27(12-10-26)35(39)37-20-16-25(17-21-37)24-6-3-2-4-7-24/h2-4,6-7,9-12,22,25,30,32-33H,5,8,13-21,23H2,1H3/t30-,32?,33+,36+/m1/s1 |
| InChIKey | XGQFKLBAQCAPAQ-YYGLGVKPSA-N |
| XLogP | 8.00 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.73 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |