C38H40F5NO3 — CID 123556419
13-methyl-17-(1,1,2,2,2-pentafluoroethoxy)-11-[4-(4-phenylpiperidine-1-carbonyl)phenyl]-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 123556419) has the molecular formula C38H40F5NO3 and a molecular weight of 653.73 g/mol. Its IUPAC name is 13-methyl-17-(1,1,2,2,2-pentafluoroethoxy)-11-[4-(4-phenylpiperidine-1-carbonyl)phenyl]-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | 13-methyl-17-(1,1,2,2,2-pentafluoroethoxy)-11-[4-(4-phenylpiperidine-1-carbonyl)phenyl]-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 123556419 |
| Molecular Formula | C38H40F5NO3 |
| Molecular Weight | 653.73 g/mol |
| Exact Mass | 653.29 |
| IUPAC Name | 13-methyl-17-(1,1,2,2,2-pentafluoroethoxy)-11-[4-(4-phenylpiperidine-1-carbonyl)phenyl]-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC12CC(c3ccc(C(=O)N4CCC(c5ccccc5)CC4)cc3)C3=C4CCC(=O)C=C4CCC3C1CCC2OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C38H40F5NO3/c1-36-22-31(25-7-9-26(10-8-25)35(46)44-19-17-24(18-20-44)23-5-3-2-4-6-23)34-29-14-12-28(45)21-27(29)11-13-30(34)32(36)15-16-33(36)47-38(42,43)37(39,40)41/h2-10,21,24,30-33H,11-20,22H2,1H3 |
| InChIKey | GAHGXVMKSAIDFR-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.73 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|