C18H28FNO — CID 67024668
(3S,8S,9R,10S,13S,14S,17S)-17-amino-9-fluoro-13-methyl-2,3,4,7,8,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 67024668) has the molecular formula C18H28FNO and a molecular weight of 293.43 g/mol. Its IUPAC name is (3S,8S,9R,10S,13S,14S,17S)-17-amino-9-fluoro-13-methyl-2,3,4,7,8,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9R,10S,13S,14S,17S)-17-amino-9-fluoro-13-methyl-2,3,4,7,8,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 67024668 |
| Molecular Formula | C18H28FNO |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | (3S,8S,9R,10S,13S,14S,17S)-17-amino-9-fluoro-13-methyl-2,3,4,7,8,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@]12CC[C@]3(F)[C@H]4CC[C@H](O)CC4=CC[C@H]3[C@@H]1CC[C@@H]2N |
| InChI | InChI=1S/C18H28FNO/c1-17-8-9-18(19)13-5-3-12(21)10-11(13)2-4-15(18)14(17)6-7-16(17)20/h2,12-16,21H,3-10,20H2,1H3/t12-,13-,14-,15-,16-,17-,18-/m0/s1 |
| InChIKey | KAIMOKUWIDGTES-GOMYCMKKSA-N |
| XLogP | 3.34 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|