C21H28N4O7S — CID 67025069
3-ethoxy-6-[2-[1-(6-methylpyridazin-3-yl)piperidin-4-yl]ethoxy]-2,1-benzoxazole;sulfuric acid (PubChem CID 67025069) has the molecular formula C21H28N4O7S and a molecular weight of 480.54 g/mol. Its IUPAC name is 3-ethoxy-6-[2-[1-(6-methylpyridazin-3-yl)piperidin-4-yl]ethoxy]-2,1-benzoxazole;sulfuric acid.
| Compound Name | 3-ethoxy-6-[2-[1-(6-methylpyridazin-3-yl)piperidin-4-yl]ethoxy]-2,1-benzoxazole;sulfuric acid |
|---|---|
| PubChem CID | 67025069 |
| Molecular Formula | C21H28N4O7S |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 3-ethoxy-6-[2-[1-(6-methylpyridazin-3-yl)piperidin-4-yl]ethoxy]-2,1-benzoxazole;sulfuric acid |
| SMILES | CCOc1onc2cc(OCCC3CCN(c4ccc(C)nn4)CC3)ccc12.O=S(=O)(O)O |
| InChI | InChI=1S/C21H26N4O3.H2O4S/c1-3-26-21-18-6-5-17(14-19(18)24-28-21)27-13-10-16-8-11-25(12-9-16)20-7-4-15(2)22-23-20;1-5(2,3)4/h4-7,14,16H,3,8-13H2,1-2H3;(H2,1,2,3,4) |
| InChIKey | CVYJWTWTLBSLAX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 148.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|