C25H33N5O2 — CID 15045185
5-[4-[2-[1-(6-methylpyridazin-3-yl)piperidin-4-yl]ethoxy]phenyl]-3-pentyl-1,2,4-oxadiazole (PubChem CID 15045185) has the molecular formula C25H33N5O2 and a molecular weight of 435.57 g/mol. Its IUPAC name is 5-[4-[2-[1-(6-methylpyridazin-3-yl)piperidin-4-yl]ethoxy]phenyl]-3-pentyl-1,2,4-oxadiazole.
| Compound Name | 5-[4-[2-[1-(6-methylpyridazin-3-yl)piperidin-4-yl]ethoxy]phenyl]-3-pentyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 15045185 |
| Molecular Formula | C25H33N5O2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | 5-[4-[2-[1-(6-methylpyridazin-3-yl)piperidin-4-yl]ethoxy]phenyl]-3-pentyl-1,2,4-oxadiazole |
| SMILES | CCCCCc1noc(-c2ccc(OCCC3CCN(c4ccc(C)nn4)CC3)cc2)n1 |
| InChI | InChI=1S/C25H33N5O2/c1-3-4-5-6-23-26-25(32-29-23)21-8-10-22(11-9-21)31-18-15-20-13-16-30(17-14-20)24-12-7-19(2)27-28-24/h7-12,20H,3-6,13-18H2,1-2H3 |
| InChIKey | KNZGTZHBLUOMGP-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 77.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|