C27H28F2N8O3 — CID 67028826
1-[4-[4,6-bis[(1S,5S,6R)-6-fluoro-3-oxa-8-azabicyclo[3.2.1]octan-8-yl]-1,3,5-triazin-2-yl]phenyl]-3-pyridin-3-ylurea (PubChem CID 67028826) has the molecular formula C27H28F2N8O3 and a molecular weight of 550.57 g/mol. Its IUPAC name is 1-[4-[4,6-bis[(1S,5S,6R)-6-fluoro-3-oxa-8-azabicyclo[3.2.1]octan-8-yl]-1,3,5-triazin-2-yl]phenyl]-3-pyridin-3-ylurea.
| Compound Name | 1-[4-[4,6-bis[(1S,5S,6R)-6-fluoro-3-oxa-8-azabicyclo[3.2.1]octan-8-yl]-1,3,5-triazin-2-yl]phenyl]-3-pyridin-3-ylurea |
|---|---|
| PubChem CID | 67028826 |
| Molecular Formula | C27H28F2N8O3 |
| Molecular Weight | 550.57 g/mol |
| Exact Mass | 550.23 |
| IUPAC Name | 1-[4-[4,6-bis[(1S,5S,6R)-6-fluoro-3-oxa-8-azabicyclo[3.2.1]octan-8-yl]-1,3,5-triazin-2-yl]phenyl]-3-pyridin-3-ylurea |
| SMILES | O=C(Nc1ccc(-c2nc(N3[C@@H]4COC[C@H]3[C@H](F)C4)nc(N3[C@@H]4COC[C@H]3[C@H](F)C4)n2)cc1)Nc1cccnc1 |
| InChI | InChI=1S/C27H28F2N8O3/c28-20-8-18-11-39-13-22(20)36(18)25-33-24(34-26(35-25)37-19-9-21(29)23(37)14-40-12-19)15-3-5-16(6-4-15)31-27(38)32-17-2-1-7-30-10-17/h1-7,10,18-23H,8-9,11-14H2,(H2,31,32,38)/t18-,19-,20+,21+,22-,23-/m0/s1 |
| InChIKey | WFLNEHDJYURIAO-QASJRYCWSA-N |
| XLogP | 3.21 |
| TPSA | 117.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.57 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |