C17H14BrFN2O2 — CID 67036441
ethyl 7-(bromomethyl)-3-(4-fluorophenyl)imidazo[1,2-a]pyridine-2-carboxylate (PubChem CID 67036441) has the molecular formula C17H14BrFN2O2 and a molecular weight of 377.21 g/mol. Its IUPAC name is ethyl 7-(bromomethyl)-3-(4-fluorophenyl)imidazo[1,2-a]pyridine-2-carboxylate.
| Compound Name | ethyl 7-(bromomethyl)-3-(4-fluorophenyl)imidazo[1,2-a]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 67036441 |
| Molecular Formula | C17H14BrFN2O2 |
| Molecular Weight | 377.21 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | ethyl 7-(bromomethyl)-3-(4-fluorophenyl)imidazo[1,2-a]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1nc2cc(CBr)ccn2c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C17H14BrFN2O2/c1-2-23-17(22)15-16(12-3-5-13(19)6-4-12)21-8-7-11(10-18)9-14(21)20-15/h3-9H,2,10H2,1H3 |
| InChIKey | CBVURCDPFVZJMT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.21 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|