C23H32ClN3O2 — CID 67037631
4-(1-benzylpiperidin-4-yl)-1-(cyclohexanecarbonyl)-2H-pyrazin-3-one;hydrochloride (PubChem CID 67037631) has the molecular formula C23H32ClN3O2 and a molecular weight of 417.98 g/mol. Its IUPAC name is 4-(1-benzylpiperidin-4-yl)-1-(cyclohexanecarbonyl)-2H-pyrazin-3-one;hydrochloride.
| Compound Name | 4-(1-benzylpiperidin-4-yl)-1-(cyclohexanecarbonyl)-2H-pyrazin-3-one;hydrochloride |
|---|---|
| PubChem CID | 67037631 |
| Molecular Formula | C23H32ClN3O2 |
| Molecular Weight | 417.98 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 4-(1-benzylpiperidin-4-yl)-1-(cyclohexanecarbonyl)-2H-pyrazin-3-one;hydrochloride |
| SMILES | Cl.O=C(C1CCCCC1)N1C=CN(C2CCN(Cc3ccccc3)CC2)C(=O)C1 |
| InChI | InChI=1S/C23H31N3O2.ClH/c27-22-18-25(23(28)20-9-5-2-6-10-20)15-16-26(22)21-11-13-24(14-12-21)17-19-7-3-1-4-8-19;/h1,3-4,7-8,15-16,20-21H,2,5-6,9-14,17-18H2;1H |
| InChIKey | OZADPNFAXOPWIL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.98 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |