C9H4Cl2N4 — CID 67042730
6-(4,5-dichloroimidazol-1-yl)pyridine-3-carbonitrile (PubChem CID 67042730) has the molecular formula C9H4Cl2N4 and a molecular weight of 239.07 g/mol. Its IUPAC name is 6-(4,5-dichloroimidazol-1-yl)pyridine-3-carbonitrile.
| Compound Name | 6-(4,5-dichloroimidazol-1-yl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 67042730 |
| Molecular Formula | C9H4Cl2N4 |
| Molecular Weight | 239.07 g/mol |
| Exact Mass | 237.98 |
| IUPAC Name | 6-(4,5-dichloroimidazol-1-yl)pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(-n2cnc(Cl)c2Cl)nc1 |
| InChI | InChI=1S/C9H4Cl2N4/c10-8-9(11)15(5-14-8)7-2-1-6(3-12)4-13-7/h1-2,4-5H |
| InChIKey | IKNKFZWUJYSGPC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.07 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |