C16H11F3N2O2 — CID 67047779
methyl N-[5-[2-[3-(trifluoromethyl)phenyl]ethynyl]-3-pyridinyl]carbamate (PubChem CID 67047779) has the molecular formula C16H11F3N2O2 and a molecular weight of 320.27 g/mol. Its IUPAC name is methyl N-[5-[2-[3-(trifluoromethyl)phenyl]ethynyl]-3-pyridinyl]carbamate.
| Compound Name | methyl N-[5-[2-[3-(trifluoromethyl)phenyl]ethynyl]-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 67047779 |
| Molecular Formula | C16H11F3N2O2 |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | methyl N-[5-[2-[3-(trifluoromethyl)phenyl]ethynyl]-3-pyridinyl]carbamate |
| SMILES | COC(=O)Nc1cncc(C#Cc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C16H11F3N2O2/c1-23-15(22)21-14-8-12(9-20-10-14)6-5-11-3-2-4-13(7-11)16(17,18)19/h2-4,7-10H,1H3,(H,21,22) |
| InChIKey | VFNJOMIBFRBBIT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|