C17H13F3N2O3 — CID 23624474
methyl 2-[1,3-dimethyl-4-[2-[3-(trifluoromethyl)phenyl]ethynyl]pyrazol-5-yl]-2-oxoacetate (PubChem CID 23624474) has the molecular formula C17H13F3N2O3 and a molecular weight of 350.30 g/mol. Its IUPAC name is methyl 2-[1,3-dimethyl-4-[2-[3-(trifluoromethyl)phenyl]ethynyl]pyrazol-5-yl]-2-oxoacetate.
| Compound Name | methyl 2-[1,3-dimethyl-4-[2-[3-(trifluoromethyl)phenyl]ethynyl]pyrazol-5-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 23624474 |
| Molecular Formula | C17H13F3N2O3 |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | methyl 2-[1,3-dimethyl-4-[2-[3-(trifluoromethyl)phenyl]ethynyl]pyrazol-5-yl]-2-oxoacetate |
| SMILES | COC(=O)C(=O)c1c(C#Cc2cccc(C(F)(F)F)c2)c(C)nn1C |
| InChI | InChI=1S/C17H13F3N2O3/c1-10-13(14(22(2)21-10)15(23)16(24)25-3)8-7-11-5-4-6-12(9-11)17(18,19)20/h4-6,9H,1-3H3 |
| InChIKey | OKSAXUTYSGRLCD-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|