C25H32N4O3 — CID 67050943
4-[(3-amino-7-phenylmethoxyquinolin-4-yl)amino]butyl-tert-butylcarbamic acid (PubChem CID 67050943) has the molecular formula C25H32N4O3 and a molecular weight of 436.56 g/mol. Its IUPAC name is 4-[(3-amino-7-phenylmethoxyquinolin-4-yl)amino]butyl-tert-butylcarbamic acid.
| Compound Name | 4-[(3-amino-7-phenylmethoxyquinolin-4-yl)amino]butyl-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 67050943 |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | 4-[(3-amino-7-phenylmethoxyquinolin-4-yl)amino]butyl-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(CCCCNc1c(N)cnc2cc(OCc3ccccc3)ccc12)C(=O)O |
| InChI | InChI=1S/C25H32N4O3/c1-25(2,3)29(24(30)31)14-8-7-13-27-23-20-12-11-19(15-22(20)28-16-21(23)26)32-17-18-9-5-4-6-10-18/h4-6,9-12,15-16H,7-8,13-14,17,26H2,1-3H3,(H,27,28)(H,30,31) |
| InChIKey | YXUWTTJUHATAIY-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|