C30H32N6O2 — CID 59268684
1-[4-[2-[[3-cyano-7-[3-(dimethylamino)propoxy]quinolin-4-yl]amino]ethyl]phenyl]-3-phenylurea (PubChem CID 59268684) has the molecular formula C30H32N6O2 and a molecular weight of 508.63 g/mol. Its IUPAC name is 1-[4-[2-[[3-cyano-7-[3-(dimethylamino)propoxy]quinolin-4-yl]amino]ethyl]phenyl]-3-phenylurea.
| Compound Name | 1-[4-[2-[[3-cyano-7-[3-(dimethylamino)propoxy]quinolin-4-yl]amino]ethyl]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 59268684 |
| Molecular Formula | C30H32N6O2 |
| Molecular Weight | 508.63 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | 1-[4-[2-[[3-cyano-7-[3-(dimethylamino)propoxy]quinolin-4-yl]amino]ethyl]phenyl]-3-phenylurea |
| SMILES | CN(C)CCCOc1ccc2c(NCCc3ccc(NC(=O)Nc4ccccc4)cc3)c(C#N)cnc2c1 |
| InChI | InChI=1S/C30H32N6O2/c1-36(2)17-6-18-38-26-13-14-27-28(19-26)33-21-23(20-31)29(27)32-16-15-22-9-11-25(12-10-22)35-30(37)34-24-7-4-3-5-8-24/h3-5,7-14,19,21H,6,15-18H2,1-2H3,(H,32,33)(H2,34,35,37) |
| InChIKey | DQVDYROIVNYDNX-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.63 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|