C33H39N7O2 — CID 59268705
1-[4-[2-[[3-cyano-7-[3-(dimethylamino)propoxy]quinolin-4-yl]amino]ethyl]phenyl]-3-[2-[(dimethylamino)methyl]phenyl]urea (PubChem CID 59268705) has the molecular formula C33H39N7O2 and a molecular weight of 565.72 g/mol. Its IUPAC name is 1-[4-[2-[[3-cyano-7-[3-(dimethylamino)propoxy]quinolin-4-yl]amino]ethyl]phenyl]-3-[2-[(dimethylamino)methyl]phenyl]urea.
| Compound Name | 1-[4-[2-[[3-cyano-7-[3-(dimethylamino)propoxy]quinolin-4-yl]amino]ethyl]phenyl]-3-[2-[(dimethylamino)methyl]phenyl]urea |
|---|---|
| PubChem CID | 59268705 |
| Molecular Formula | C33H39N7O2 |
| Molecular Weight | 565.72 g/mol |
| Exact Mass | 565.32 |
| IUPAC Name | 1-[4-[2-[[3-cyano-7-[3-(dimethylamino)propoxy]quinolin-4-yl]amino]ethyl]phenyl]-3-[2-[(dimethylamino)methyl]phenyl]urea |
| SMILES | CN(C)CCCOc1ccc2c(NCCc3ccc(NC(=O)Nc4ccccc4CN(C)C)cc3)c(C#N)cnc2c1 |
| InChI | InChI=1S/C33H39N7O2/c1-39(2)18-7-19-42-28-14-15-29-31(20-28)36-22-26(21-34)32(29)35-17-16-24-10-12-27(13-11-24)37-33(41)38-30-9-6-5-8-25(30)23-40(3)4/h5-6,8-15,20,22H,7,16-19,23H2,1-4H3,(H,35,36)(H2,37,38,41) |
| InChIKey | NCCJJBPELZCUGB-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 105.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.72 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|