C31H38N4O4 — CID 67051010
N-[1-[2-(ethoxymethyl)-5-oxido-8-phenylmethoxyimidazo[4,5-c]quinolin-5-ium-1-yl]-2-methylpropan-2-yl]cyclohexanecarboxamide (PubChem CID 67051010) has the molecular formula C31H38N4O4 and a molecular weight of 530.67 g/mol. Its IUPAC name is N-[1-[2-(ethoxymethyl)-5-oxido-8-phenylmethoxyimidazo[4,5-c]quinolin-5-ium-1-yl]-2-methylpropan-2-yl]cyclohexanecarboxamide.
| Compound Name | N-[1-[2-(ethoxymethyl)-5-oxido-8-phenylmethoxyimidazo[4,5-c]quinolin-5-ium-1-yl]-2-methylpropan-2-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 67051010 |
| Molecular Formula | C31H38N4O4 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | N-[1-[2-(ethoxymethyl)-5-oxido-8-phenylmethoxyimidazo[4,5-c]quinolin-5-ium-1-yl]-2-methylpropan-2-yl]cyclohexanecarboxamide |
| SMILES | CCOCc1nc2c[n+]([O-])c3ccc(OCc4ccccc4)cc3c2n1CC(C)(C)NC(=O)C1CCCCC1 |
| InChI | InChI=1S/C31H38N4O4/c1-4-38-20-28-32-26-18-35(37)27-16-15-24(39-19-22-11-7-5-8-12-22)17-25(27)29(26)34(28)21-31(2,3)33-30(36)23-13-9-6-10-14-23/h5,7-8,11-12,15-18,23H,4,6,9-10,13-14,19-21H2,1-3H3,(H,33,36) |
| InChIKey | ALPQKFLNYRGHGW-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|