C14H21BN2O4 — CID 67052464
[phenyl(propylcarbamoyloxy)boranyl] N-propylcarbamate (PubChem CID 67052464) has the molecular formula C14H21BN2O4 and a molecular weight of 292.14 g/mol. Its IUPAC name is [phenyl(propylcarbamoyloxy)boranyl] N-propylcarbamate.
| Compound Name | [phenyl(propylcarbamoyloxy)boranyl] N-propylcarbamate |
|---|---|
| PubChem CID | 67052464 |
| Molecular Formula | C14H21BN2O4 |
| Molecular Weight | 292.14 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | [phenyl(propylcarbamoyloxy)boranyl] N-propylcarbamate |
| SMILES | CCCNC(=O)OB(OC(=O)NCCC)c1ccccc1 |
| InChI | InChI=1S/C14H21BN2O4/c1-3-10-16-13(18)20-15(12-8-6-5-7-9-12)21-14(19)17-11-4-2/h5-9H,3-4,10-11H2,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | HXAOEZMLUWTJKV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.14 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|