C19H18ClF3O4 — CID 67058088
3-[4-[[2-chloro-3-(trifluoromethyl)phenyl]methoxy]phenyl]-3-ethoxypropanoic acid (PubChem CID 67058088) has the molecular formula C19H18ClF3O4 and a molecular weight of 402.80 g/mol. Its IUPAC name is 3-[4-[[2-chloro-3-(trifluoromethyl)phenyl]methoxy]phenyl]-3-ethoxypropanoic acid.
| Compound Name | 3-[4-[[2-chloro-3-(trifluoromethyl)phenyl]methoxy]phenyl]-3-ethoxypropanoic acid |
|---|---|
| PubChem CID | 67058088 |
| Molecular Formula | C19H18ClF3O4 |
| Molecular Weight | 402.80 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | 3-[4-[[2-chloro-3-(trifluoromethyl)phenyl]methoxy]phenyl]-3-ethoxypropanoic acid |
| SMILES | CCOC(CC(=O)O)c1ccc(OCc2cccc(C(F)(F)F)c2Cl)cc1 |
| InChI | InChI=1S/C19H18ClF3O4/c1-2-26-16(10-17(24)25)12-6-8-14(9-7-12)27-11-13-4-3-5-15(18(13)20)19(21,22)23/h3-9,16H,2,10-11H2,1H3,(H,24,25) |
| InChIKey | DGRXNXATGWMDDG-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.80 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |