C23H29NO4 — CID 67058139
3-ethoxy-3-[4-[(1-phenylpiperidin-4-yl)methoxy]phenyl]propanoic acid (PubChem CID 67058139) has the molecular formula C23H29NO4 and a molecular weight of 383.49 g/mol. Its IUPAC name is 3-ethoxy-3-[4-[(1-phenylpiperidin-4-yl)methoxy]phenyl]propanoic acid.
| Compound Name | 3-ethoxy-3-[4-[(1-phenylpiperidin-4-yl)methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 67058139 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 3-ethoxy-3-[4-[(1-phenylpiperidin-4-yl)methoxy]phenyl]propanoic acid |
| SMILES | CCOC(CC(=O)O)c1ccc(OCC2CCN(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C23H29NO4/c1-2-27-22(16-23(25)26)19-8-10-21(11-9-19)28-17-18-12-14-24(15-13-18)20-6-4-3-5-7-20/h3-11,18,22H,2,12-17H2,1H3,(H,25,26) |
| InChIKey | ZLQWTUAMZSHWGU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |