C24H33N3O5S — CID 18918485
3-(butylsulfonylamino)-3-[4-[(1-pyridin-4-ylpiperidin-4-yl)methoxy]phenyl]propanoic acid (PubChem CID 18918485) has the molecular formula C24H33N3O5S and a molecular weight of 475.61 g/mol. Its IUPAC name is 3-(butylsulfonylamino)-3-[4-[(1-pyridin-4-ylpiperidin-4-yl)methoxy]phenyl]propanoic acid.
| Compound Name | 3-(butylsulfonylamino)-3-[4-[(1-pyridin-4-ylpiperidin-4-yl)methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 18918485 |
| Molecular Formula | C24H33N3O5S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | 3-(butylsulfonylamino)-3-[4-[(1-pyridin-4-ylpiperidin-4-yl)methoxy]phenyl]propanoic acid |
| SMILES | CCCCS(=O)(=O)NC(CC(=O)O)c1ccc(OCC2CCN(c3ccncc3)CC2)cc1 |
| InChI | InChI=1S/C24H33N3O5S/c1-2-3-16-33(30,31)26-23(17-24(28)29)20-4-6-22(7-5-20)32-18-19-10-14-27(15-11-19)21-8-12-25-13-9-21/h4-9,12-13,19,23,26H,2-3,10-11,14-18H2,1H3,(H,28,29) |
| InChIKey | QPAWTCMDWDIEBH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |