C23H32O4 — CID 70836468
(3S)-3-ethoxy-3-[4-(spiro[5.5]undec-4-en-4-ylmethoxy)phenyl]propanoic acid (PubChem CID 70836468) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is (3S)-3-ethoxy-3-[4-(spiro[5.5]undec-4-en-4-ylmethoxy)phenyl]propanoic acid.
| Compound Name | (3S)-3-ethoxy-3-[4-(spiro[5.5]undec-4-en-4-ylmethoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 70836468 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | (3S)-3-ethoxy-3-[4-(spiro[5.5]undec-4-en-4-ylmethoxy)phenyl]propanoic acid |
| SMILES | CCO[C@@H](CC(=O)O)c1ccc(OCC2=CC3(CCCCC3)CCC2)cc1 |
| InChI | InChI=1S/C23H32O4/c1-2-26-21(15-22(24)25)19-8-10-20(11-9-19)27-17-18-7-6-14-23(16-18)12-4-3-5-13-23/h8-11,16,21H,2-7,12-15,17H2,1H3,(H,24,25)/t21-/m0/s1 |
| InChIKey | UGKFVHKHPSUAKC-NRFANRHFSA-N |
| XLogP | 5.68 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|