C46H54NaO6- — CID 157077031
sodium bis((3S)-3-[4-(spiro[4.5]dec-9-en-9-ylmethoxy)phenyl]hex-4-ynoate) (PubChem CID 157077031) has the molecular formula C46H54NaO6- and a molecular weight of 725.92 g/mol. Its IUPAC name is sodium bis((3S)-3-[4-(spiro[4.5]dec-9-en-9-ylmethoxy)phenyl]hex-4-ynoate).
| Compound Name | sodium bis((3S)-3-[4-(spiro[4.5]dec-9-en-9-ylmethoxy)phenyl]hex-4-ynoate) |
|---|---|
| PubChem CID | 157077031 |
| Molecular Formula | C46H54NaO6- |
| Molecular Weight | 725.92 g/mol |
| Exact Mass | 725.38 |
| IUPAC Name | sodium bis((3S)-3-[4-(spiro[4.5]dec-9-en-9-ylmethoxy)phenyl]hex-4-ynoate) |
| SMILES | CC#C[C@@H](CC(=O)[O-])c1ccc(OCC2=CC3(CCCC3)CCC2)cc1.CC#C[C@@H](CC(=O)[O-])c1ccc(OCC2=CC3(CCCC3)CCC2)cc1.[Na+] |
| InChI | InChI=1S/2C23H28O3.Na/c2*1-2-6-20(15-22(24)25)19-8-10-21(11-9-19)26-17-18-7-5-14-23(16-18)12-3-4-13-23;/h2*8-11,16,20H,3-5,7,12-15,17H2,1H3,(H,24,25);/q;;+1/p-2/t2*20-;/m00./s1 |
| InChIKey | ADBZARDTIPDUJL-WQXCQFITSA-L |
| XLogP | 4.97 |
| TPSA | 98.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.92 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|