C22H26O3 — CID 42602613
(3S)-3-[4-(spiro[4.4]non-2-en-3-ylmethoxy)phenyl]hex-4-ynoic acid (PubChem CID 42602613) has the molecular formula C22H26O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is (3S)-3-[4-(spiro[4.4]non-2-en-3-ylmethoxy)phenyl]hex-4-ynoic acid.
| Compound Name | (3S)-3-[4-(spiro[4.4]non-2-en-3-ylmethoxy)phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 42602613 |
| Molecular Formula | C22H26O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | (3S)-3-[4-(spiro[4.4]non-2-en-3-ylmethoxy)phenyl]hex-4-ynoic acid |
| SMILES | CC#C[C@@H](CC(=O)O)c1ccc(OCC2=CCC3(CCCC3)C2)cc1 |
| InChI | InChI=1S/C22H26O3/c1-2-5-19(14-21(23)24)18-6-8-20(9-7-18)25-16-17-10-13-22(15-17)11-3-4-12-22/h6-10,19H,3-4,11-16H2,1H3,(H,23,24)/t19-/m0/s1 |
| InChIKey | NKGYCDKILAMADV-IBGZPJMESA-N |
| XLogP | 4.93 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|