C23H31NaO3 — CID 173098315
sodium;hydride;(3S)-3-[4-(spiro[4.5]decan-9-ylmethoxy)phenyl]hex-4-ynoic acid (PubChem CID 173098315) has the molecular formula C23H31NaO3 and a molecular weight of 378.49 g/mol. Its IUPAC name is sodium;hydride;(3S)-3-[4-(spiro[4.5]decan-9-ylmethoxy)phenyl]hex-4-ynoic acid.
| Compound Name | sodium;hydride;(3S)-3-[4-(spiro[4.5]decan-9-ylmethoxy)phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 173098315 |
| Molecular Formula | C23H31NaO3 |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | sodium;hydride;(3S)-3-[4-(spiro[4.5]decan-9-ylmethoxy)phenyl]hex-4-ynoic acid |
| SMILES | CC#C[C@@H](CC(=O)O)c1ccc(OCC2CCCC3(CCCC3)C2)cc1.[H-].[Na+] |
| InChI | InChI=1S/C23H30O3.Na.H/c1-2-6-20(15-22(24)25)19-8-10-21(11-9-19)26-17-18-7-5-14-23(16-18)12-3-4-13-23;;/h8-11,18,20H,3-5,7,12-17H2,1H3,(H,24,25);;/q;+1;-1/t18?,20-;;/m0../s1 |
| InChIKey | JVDISMKBGGCTIK-FEFQNAGISA-N |
| XLogP | 2.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|