C23H30O4 — CID 143797218
3-[4-[[3-(3-hydroxybutyl)cyclohexen-1-yl]methoxy]phenyl]hex-4-ynoic acid (PubChem CID 143797218) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is 3-[4-[[3-(3-hydroxybutyl)cyclohexen-1-yl]methoxy]phenyl]hex-4-ynoic acid.
| Compound Name | 3-[4-[[3-(3-hydroxybutyl)cyclohexen-1-yl]methoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 143797218 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 3-[4-[[3-(3-hydroxybutyl)cyclohexen-1-yl]methoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#CC(CC(=O)O)c1ccc(OCC2=CC(CCC(C)O)CCC2)cc1 |
| InChI | InChI=1S/C23H30O4/c1-3-5-21(15-23(25)26)20-10-12-22(13-11-20)27-16-19-7-4-6-18(14-19)9-8-17(2)24/h10-14,17-18,21,24H,4,6-9,15-16H2,1-2H3,(H,25,26) |
| InChIKey | FEZULEMIROZTEI-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|