C23H30O3 — CID 143797316
methyl 3-[4-[(3-butylcyclohexen-1-yl)methoxy]phenyl]pent-4-ynoate (PubChem CID 143797316) has the molecular formula C23H30O3 and a molecular weight of 354.49 g/mol. Its IUPAC name is methyl 3-[4-[(3-butylcyclohexen-1-yl)methoxy]phenyl]pent-4-ynoate.
| Compound Name | methyl 3-[4-[(3-butylcyclohexen-1-yl)methoxy]phenyl]pent-4-ynoate |
|---|---|
| PubChem CID | 143797316 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | methyl 3-[4-[(3-butylcyclohexen-1-yl)methoxy]phenyl]pent-4-ynoate |
| SMILES | C#CC(CC(=O)OC)c1ccc(OCC2=CC(CCCC)CCC2)cc1 |
| InChI | InChI=1S/C23H30O3/c1-4-6-8-18-9-7-10-19(15-18)17-26-22-13-11-21(12-14-22)20(5-2)16-23(24)25-3/h2,11-15,18,20H,4,6-10,16-17H2,1,3H3 |
| InChIKey | SBOXFFBVTKSTTH-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|