C22H31NO3S — CID 143797261
amino 3-[4-[[(3R)-3-butylcyclohexen-1-yl]methoxy]phenyl]-3-(ethylidyne-λ4-sulfanyl)propanoate (PubChem CID 143797261) has the molecular formula C22H31NO3S and a molecular weight of 389.56 g/mol. Its IUPAC name is amino 3-[4-[[(3R)-3-butylcyclohexen-1-yl]methoxy]phenyl]-3-(ethylidyne-λ4-sulfanyl)propanoate.
| Compound Name | amino 3-[4-[[(3R)-3-butylcyclohexen-1-yl]methoxy]phenyl]-3-(ethylidyne-λ4-sulfanyl)propanoate |
|---|---|
| PubChem CID | 143797261 |
| Molecular Formula | C22H31NO3S |
| Molecular Weight | 389.56 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | amino 3-[4-[[(3R)-3-butylcyclohexen-1-yl]methoxy]phenyl]-3-(ethylidyne-λ4-sulfanyl)propanoate |
| SMILES | CC#SC(CC(=O)ON)c1ccc(OCC2=C[C@H](CCCC)CCC2)cc1 |
| InChI | InChI=1S/C22H31NO3S/c1-3-5-7-17-8-6-9-18(14-17)16-25-20-12-10-19(11-13-20)21(27-4-2)15-22(24)26-23/h10-14,17,21H,3,5-9,15-16,23H2,1-2H3/t17-,21?/m1/s1 |
| InChIKey | RDWXYGIWGVVAMA-OQHSHRKDSA-N |
| XLogP | 5.54 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.56 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|