C23H30BNO5 — CID 70938339
6-methyl-2-[4-(spiro[5.5]undec-4-en-4-ylmethoxy)phenyl]-1,3,6,2-dioxazaborocane-4,8-dione (PubChem CID 70938339) has the molecular formula C23H30BNO5 and a molecular weight of 411.31 g/mol. Its IUPAC name is 6-methyl-2-[4-(spiro[5.5]undec-4-en-4-ylmethoxy)phenyl]-1,3,6,2-dioxazaborocane-4,8-dione.
| Compound Name | 6-methyl-2-[4-(spiro[5.5]undec-4-en-4-ylmethoxy)phenyl]-1,3,6,2-dioxazaborocane-4,8-dione |
|---|---|
| PubChem CID | 70938339 |
| Molecular Formula | C23H30BNO5 |
| Molecular Weight | 411.31 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 6-methyl-2-[4-(spiro[5.5]undec-4-en-4-ylmethoxy)phenyl]-1,3,6,2-dioxazaborocane-4,8-dione |
| SMILES | CN1CC(=O)OB(c2ccc(OCC3=CC4(CCCCC4)CCC3)cc2)OC(=O)C1 |
| InChI | InChI=1S/C23H30BNO5/c1-25-15-21(26)29-24(30-22(27)16-25)19-7-9-20(10-8-19)28-17-18-6-5-13-23(14-18)11-3-2-4-12-23/h7-10,14H,2-6,11-13,15-17H2,1H3 |
| InChIKey | SDFBLKPYTKODLL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|