C21H14Cl2N8 — CID 67060351
4-[2-[(5-cyano-2-pyridinyl)amino]ethylamino]-6-(2,4-dichlorophenyl)pyrazolo[1,5-a]pyrazine-2-carbonitrile (PubChem CID 67060351) has the molecular formula C21H14Cl2N8 and a molecular weight of 449.31 g/mol. Its IUPAC name is 4-[2-[(5-cyano-2-pyridinyl)amino]ethylamino]-6-(2,4-dichlorophenyl)pyrazolo[1,5-a]pyrazine-2-carbonitrile.
| Compound Name | 4-[2-[(5-cyano-2-pyridinyl)amino]ethylamino]-6-(2,4-dichlorophenyl)pyrazolo[1,5-a]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 67060351 |
| Molecular Formula | C21H14Cl2N8 |
| Molecular Weight | 449.31 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | 4-[2-[(5-cyano-2-pyridinyl)amino]ethylamino]-6-(2,4-dichlorophenyl)pyrazolo[1,5-a]pyrazine-2-carbonitrile |
| SMILES | N#Cc1ccc(NCCNc2nc(-c3ccc(Cl)cc3Cl)cn3nc(C#N)cc23)nc1 |
| InChI | InChI=1S/C21H14Cl2N8/c22-14-2-3-16(17(23)7-14)18-12-31-19(8-15(10-25)30-31)21(29-18)27-6-5-26-20-4-1-13(9-24)11-28-20/h1-4,7-8,11-12H,5-6H2,(H,26,28)(H,27,29) |
| InChIKey | HQIVFIUIZJQBSS-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 114.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.31 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|