C12H16ClN3O2S — CID 67060540
ethyl 5-(3-aminopyrrolidin-1-yl)-4-cyanothiophene-2-carboxylate;hydrochloride (PubChem CID 67060540) has the molecular formula C12H16ClN3O2S and a molecular weight of 301.80 g/mol. Its IUPAC name is ethyl 5-(3-aminopyrrolidin-1-yl)-4-cyanothiophene-2-carboxylate;hydrochloride.
| Compound Name | ethyl 5-(3-aminopyrrolidin-1-yl)-4-cyanothiophene-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 67060540 |
| Molecular Formula | C12H16ClN3O2S |
| Molecular Weight | 301.80 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | ethyl 5-(3-aminopyrrolidin-1-yl)-4-cyanothiophene-2-carboxylate;hydrochloride |
| SMILES | CCOC(=O)c1cc(C#N)c(N2CCC(N)C2)s1.Cl |
| InChI | InChI=1S/C12H15N3O2S.ClH/c1-2-17-12(16)10-5-8(6-13)11(18-10)15-4-3-9(14)7-15;/h5,9H,2-4,7,14H2,1H3;1H |
| InChIKey | ILFBZTWXCIZBHM-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 79.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.80 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |