C25H35BN2O5S — CID 67066191
tert-butyl-[3-phenyl-2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carbonyl]amino]propyl]carbamic acid (PubChem CID 67066191) has the molecular formula C25H35BN2O5S and a molecular weight of 486.44 g/mol. Its IUPAC name is tert-butyl-[3-phenyl-2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carbonyl]amino]propyl]carbamic acid.
| Compound Name | tert-butyl-[3-phenyl-2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carbonyl]amino]propyl]carbamic acid |
|---|---|
| PubChem CID | 67066191 |
| Molecular Formula | C25H35BN2O5S |
| Molecular Weight | 486.44 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | tert-butyl-[3-phenyl-2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carbonyl]amino]propyl]carbamic acid |
| SMILES | CC(C)(C)N(CC(Cc1ccccc1)NC(=O)c1ccc(B2OC(C)(C)C(C)(C)O2)s1)C(=O)O |
| InChI | InChI=1S/C25H35BN2O5S/c1-23(2,3)28(22(30)31)16-18(15-17-11-9-8-10-12-17)27-21(29)19-13-14-20(34-19)26-32-24(4,5)25(6,7)33-26/h8-14,18H,15-16H2,1-7H3,(H,27,29)(H,30,31) |
| InChIKey | VSRIOHIDPIRJLF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|