About tert-butyl-[2-[(4,5-dibromothiophene-2-carbonyl)amino]-3-phenylpropyl]carbamic acid
tert-butyl-[2-[(4,5-dibromothiophene-2-carbonyl)amino]-3-phenylpropyl]carbamic acid (PubChem CID 67066198) has the molecular formula C19H22Br2N2O3S
and a molecular weight of 518.27 g/mol. Its IUPAC name is tert-butyl-[2-[(4,5-dibromothiophene-2-carbonyl)amino]-3-phenylpropyl]carbamic acid.
Molecular Properties
| Compound Name | tert-butyl-[2-[(4,5-dibromothiophene-2-carbonyl)amino]-3-phenylpropyl]carbamic acid |
| PubChem CID | 67066198 |
| Molecular Formula | C19H22Br2N2O3S |
| Molecular Weight | 518.27 g/mol |
| Exact Mass | 515.97 |
| IUPAC Name | tert-butyl-[2-[(4,5-dibromothiophene-2-carbonyl)amino]-3-phenylpropyl]carbamic acid |
| SMILES | CC(C)(C)N(CC(Cc1ccccc1)NC(=O)c1cc(Br)c(Br)s1)C(=O)O |
| InChI | InChI=1S/C19H22Br2N2O3S/c1-19(2,3)23(18(25)26)11-13(9-12-7-5-4-6-8-12)22-17(24)15-10-14(20)16(21)27-15/h4-8,10,13H,9,11H2,1-3H3,(H,22,24)(H,25,26) |
| InChIKey | DQAJKDMCUQNZJS-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 518.27 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl-[2-[(4,5-dibromothiophene-2-carbonyl)amino]-3-phenylpropyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[2-[(4,5-dibromothiophene-2-carbonyl)amino]-3-phenylpropyl]carbamic acid?
The IUPAC name of tert-butyl-[2-[(4,5-dibromothiophene-2-carbonyl)amino]-3-phenylpropyl]carbamic acid (CID 67066198) is tert-butyl-[2-[(4,5-dibromothiophene-2-carbonyl)amino]-3-phenylpropyl]carbamic acid.
What is the SMILES notation for tert-butyl-[2-[(4,5-dibromothiophene-2-carbonyl)amino]-3-phenylpropyl]carbamic acid?
The canonical SMILES for tert-butyl-[2-[(4,5-dibromothiophene-2-carbonyl)amino]-3-phenylpropyl]carbamic acid is CC(C)(C)N(CC(Cc1ccccc1)NC(=O)c1cc(Br)c(Br)s1)C(=O)O.
What is the InChIKey of tert-butyl-[2-[(4,5-dibromothiophene-2-carbonyl)amino]-3-phenylpropyl]carbamic acid?
The InChIKey is DQAJKDMCUQNZJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22Br2N2O3S/c1-19(2,3)23(18(25)26)11-13(9-12-7-5-4-6-8-12)22-17(24)15-10-14(20)16(21)27-15/h4-8,10,13H,9,11H2,1-3H3,(H,22,24)(H,25,26).
What are the key properties of tert-butyl-[2-[(4,5-dibromothiophene-2-carbonyl)amino]-3-phenylpropyl]carbamic acid?
tert-butyl-[2-[(4,5-dibromothiophene-2-carbonyl)amino]-3-phenylpropyl]carbamic acid has a molecular weight of 518.27 g/mol, XLogP of 5.39, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[2-[(4,5-dibromothiophene-2-carbonyl)amino]-3-phenylpropyl]carbamic acid is sourced from PubChem (CID 67066198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).