C16H17BrClNOS — CID 58201566
4-bromo-5-chloro-N-[(2R)-1-phenylpentan-2-yl]thiophene-2-carboxamide (PubChem CID 58201566) has the molecular formula C16H17BrClNOS and a molecular weight of 386.74 g/mol. Its IUPAC name is 4-bromo-5-chloro-N-[(2R)-1-phenylpentan-2-yl]thiophene-2-carboxamide.
| Compound Name | 4-bromo-5-chloro-N-[(2R)-1-phenylpentan-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 58201566 |
| Molecular Formula | C16H17BrClNOS |
| Molecular Weight | 386.74 g/mol |
| Exact Mass | 384.99 |
| IUPAC Name | 4-bromo-5-chloro-N-[(2R)-1-phenylpentan-2-yl]thiophene-2-carboxamide |
| SMILES | CCC[C@H](Cc1ccccc1)NC(=O)c1cc(Br)c(Cl)s1 |
| InChI | InChI=1S/C16H17BrClNOS/c1-2-6-12(9-11-7-4-3-5-8-11)19-16(20)14-10-13(17)15(18)21-14/h3-5,7-8,10,12H,2,6,9H2,1H3,(H,19,20)/t12-/m1/s1 |
| InChIKey | IUFZYOPJXKUYFR-GFCCVEGCSA-N |
| XLogP | 5.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.74 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |