C19H23FN2O3S2 — CID 143499401
tert-butyl N-[2-[(5-fluorosulfanylthiophene-2-carbonyl)amino]-3-phenylpropyl]carbamate (PubChem CID 143499401) has the molecular formula C19H23FN2O3S2 and a molecular weight of 410.54 g/mol. Its IUPAC name is tert-butyl N-[2-[(5-fluorosulfanylthiophene-2-carbonyl)amino]-3-phenylpropyl]carbamate.
| Compound Name | tert-butyl N-[2-[(5-fluorosulfanylthiophene-2-carbonyl)amino]-3-phenylpropyl]carbamate |
|---|---|
| PubChem CID | 143499401 |
| Molecular Formula | C19H23FN2O3S2 |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | tert-butyl N-[2-[(5-fluorosulfanylthiophene-2-carbonyl)amino]-3-phenylpropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(Cc1ccccc1)NC(=O)c1ccc(SF)s1 |
| InChI | InChI=1S/C19H23FN2O3S2/c1-19(2,3)25-18(24)21-12-14(11-13-7-5-4-6-8-13)22-17(23)15-9-10-16(26-15)27-20/h4-10,14H,11-12H2,1-3H3,(H,21,24)(H,22,23) |
| InChIKey | JROULHQWVOELAX-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |