About pyrido[3,2-d]pyrimidine;pyrido[3,4-d]pyrimidine;pyrido[4,3-d]pyrimidine
pyrido[3,2-d]pyrimidine;pyrido[3,4-d]pyrimidine;pyrido[4,3-d]pyrimidine (PubChem CID 67067545) has the molecular formula C21H15N9
and a molecular weight of 393.41 g/mol. Its IUPAC name is pyrido[3,2-d]pyrimidine;pyrido[3,4-d]pyrimidine;pyrido[4,3-d]pyrimidine.
Molecular Properties
| Compound Name | pyrido[3,2-d]pyrimidine;pyrido[3,4-d]pyrimidine;pyrido[4,3-d]pyrimidine |
| PubChem CID | 67067545 |
| Molecular Formula | C21H15N9 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | pyrido[3,2-d]pyrimidine;pyrido[3,4-d]pyrimidine;pyrido[4,3-d]pyrimidine |
| SMILES | c1cc2cncnc2cn1.c1cc2ncncc2cn1.c1cnc2cncnc2c1 |
| InChI | InChI=1S/3C7H5N3/c1-2-8-3-6-4-9-5-10-7(1)6;1-2-8-4-7-6(1)3-9-5-10-7;1-2-6-7(9-3-1)4-8-5-10-6/h3*1-5H |
| InChIKey | FAUGGJSQQXDQTN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 116.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze pyrido[3,2-d]pyrimidine;pyrido[3,4-d]pyrimidine;pyrido[4,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrido[3,2-d]pyrimidine;pyrido[3,4-d]pyrimidine;pyrido[4,3-d]pyrimidine?
The IUPAC name of pyrido[3,2-d]pyrimidine;pyrido[3,4-d]pyrimidine;pyrido[4,3-d]pyrimidine (CID 67067545) is pyrido[3,2-d]pyrimidine;pyrido[3,4-d]pyrimidine;pyrido[4,3-d]pyrimidine.
What is the SMILES notation for pyrido[3,2-d]pyrimidine;pyrido[3,4-d]pyrimidine;pyrido[4,3-d]pyrimidine?
The canonical SMILES for pyrido[3,2-d]pyrimidine;pyrido[3,4-d]pyrimidine;pyrido[4,3-d]pyrimidine is c1cc2cncnc2cn1.c1cc2ncncc2cn1.c1cnc2cncnc2c1.
What is the InChIKey of pyrido[3,2-d]pyrimidine;pyrido[3,4-d]pyrimidine;pyrido[4,3-d]pyrimidine?
The InChIKey is FAUGGJSQQXDQTN-UHFFFAOYSA-N. The full InChI is InChI=1S/3C7H5N3/c1-2-8-3-6-4-9-5-10-7(1)6;1-2-8-4-7-6(1)3-9-5-10-7;1-2-6-7(9-3-1)4-8-5-10-6/h3*1-5H.
What are the key properties of pyrido[3,2-d]pyrimidine;pyrido[3,4-d]pyrimidine;pyrido[4,3-d]pyrimidine?
pyrido[3,2-d]pyrimidine;pyrido[3,4-d]pyrimidine;pyrido[4,3-d]pyrimidine has a molecular weight of 393.41 g/mol, XLogP of 3.07, 0 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for pyrido[3,2-d]pyrimidine;pyrido[3,4-d]pyrimidine;pyrido[4,3-d]pyrimidine is sourced from PubChem (CID 67067545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).