About isocyanic acid;1,6-naphthyridine
isocyanic acid;1,6-naphthyridine (PubChem CID 174611151) has the molecular formula C9H7N3O
and a molecular weight of 173.17 g/mol. Its IUPAC name is isocyanic acid;1,6-naphthyridine.
Molecular Properties
| Compound Name | isocyanic acid;1,6-naphthyridine |
| PubChem CID | 174611151 |
| Molecular Formula | C9H7N3O |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | isocyanic acid;1,6-naphthyridine |
| SMILES | N=C=O.c1cnc2ccncc2c1 |
| InChI | InChI=1S/C8H6N2.CHNO/c1-2-7-6-9-5-3-8(7)10-4-1;2-1-3/h1-6H;2H |
| InChIKey | MVDRYHWVESVYQR-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 66.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze isocyanic acid;1,6-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isocyanic acid;1,6-naphthyridine?
The IUPAC name of isocyanic acid;1,6-naphthyridine (CID 174611151) is isocyanic acid;1,6-naphthyridine.
What is the SMILES notation for isocyanic acid;1,6-naphthyridine?
The canonical SMILES for isocyanic acid;1,6-naphthyridine is N=C=O.c1cnc2ccncc2c1.
What is the InChIKey of isocyanic acid;1,6-naphthyridine?
The InChIKey is MVDRYHWVESVYQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2.CHNO/c1-2-7-6-9-5-3-8(7)10-4-1;2-1-3/h1-6H;2H.
What are the key properties of isocyanic acid;1,6-naphthyridine?
isocyanic acid;1,6-naphthyridine has a molecular weight of 173.17 g/mol, XLogP of 1.53, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for isocyanic acid;1,6-naphthyridine is sourced from PubChem (CID 174611151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).