About diazomethanone;quinoline
diazomethanone;quinoline (PubChem CID 87207818) has the molecular formula C10H7N3O
and a molecular weight of 185.19 g/mol. Its IUPAC name is diazomethanone;quinoline.
Molecular Properties
| Compound Name | diazomethanone;quinoline |
| PubChem CID | 87207818 |
| Molecular Formula | C10H7N3O |
| Molecular Weight | 185.19 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | diazomethanone;quinoline |
| SMILES | [N-]=[N+]=C=O.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.CN2O/c1-2-6-9-8(4-1)5-3-7-10-9;2-3-1-4/h1-7H; |
| InChIKey | HSJNRCOUFMURIE-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.19 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze diazomethanone;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diazomethanone;quinoline?
The IUPAC name of diazomethanone;quinoline (CID 87207818) is diazomethanone;quinoline.
What is the SMILES notation for diazomethanone;quinoline?
The canonical SMILES for diazomethanone;quinoline is [N-]=[N+]=C=O.c1ccc2ncccc2c1.
What is the InChIKey of diazomethanone;quinoline?
The InChIKey is HSJNRCOUFMURIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.CN2O/c1-2-6-9-8(4-1)5-3-7-10-9;2-3-1-4/h1-7H;.
What are the key properties of diazomethanone;quinoline?
diazomethanone;quinoline has a molecular weight of 185.19 g/mol, XLogP of 1.79, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diazomethanone;quinoline is sourced from PubChem (CID 87207818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).