C13H17N3O2 — CID 67074597
1-pyridin-3-yl-1,7-diazaspiro[4.4]nonane-7-carboxylic acid (PubChem CID 67074597) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 1-pyridin-3-yl-1,7-diazaspiro[4.4]nonane-7-carboxylic acid.
| Compound Name | 1-pyridin-3-yl-1,7-diazaspiro[4.4]nonane-7-carboxylic acid |
|---|---|
| PubChem CID | 67074597 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 1-pyridin-3-yl-1,7-diazaspiro[4.4]nonane-7-carboxylic acid |
| SMILES | O=C(O)N1CCC2(CCCN2c2cccnc2)C1 |
| InChI | InChI=1S/C13H17N3O2/c17-12(18)15-8-5-13(10-15)4-2-7-16(13)11-3-1-6-14-9-11/h1,3,6,9H,2,4-5,7-8,10H2,(H,17,18) |
| InChIKey | RGMKHOAYAPOONN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |