C32H38IN7O2Si — CID 67080713
N-[2-[3-[1-(iodomethyl)pyrazol-4-yl]-5-[[6-(2-trimethylsilylethynyl)quinazolin-2-yl]amino]phenoxy]ethyl]-2-piperidin-1-ylacetamide (PubChem CID 67080713) has the molecular formula C32H38IN7O2Si and a molecular weight of 707.69 g/mol. Its IUPAC name is N-[2-[3-[1-(iodomethyl)pyrazol-4-yl]-5-[[6-(2-trimethylsilylethynyl)quinazolin-2-yl]amino]phenoxy]ethyl]-2-piperidin-1-ylacetamide.
| Compound Name | N-[2-[3-[1-(iodomethyl)pyrazol-4-yl]-5-[[6-(2-trimethylsilylethynyl)quinazolin-2-yl]amino]phenoxy]ethyl]-2-piperidin-1-ylacetamide |
|---|---|
| PubChem CID | 67080713 |
| Molecular Formula | C32H38IN7O2Si |
| Molecular Weight | 707.69 g/mol |
| Exact Mass | 707.19 |
| IUPAC Name | N-[2-[3-[1-(iodomethyl)pyrazol-4-yl]-5-[[6-(2-trimethylsilylethynyl)quinazolin-2-yl]amino]phenoxy]ethyl]-2-piperidin-1-ylacetamide |
| SMILES | C[Si](C)(C)C#Cc1ccc2nc(Nc3cc(OCCNC(=O)CN4CCCCC4)cc(-c4cnn(CI)c4)c3)ncc2c1 |
| InChI | InChI=1S/C32H38IN7O2Si/c1-43(2,3)14-9-24-7-8-30-26(15-24)19-35-32(38-30)37-28-16-25(27-20-36-40(21-27)23-33)17-29(18-28)42-13-10-34-31(41)22-39-11-5-4-6-12-39/h7-8,15-21H,4-6,10-13,22-23H2,1-3H3,(H,34,41)(H,35,37,38) |
| InChIKey | AFAFWTZIYZJSHZ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.69 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|