C25H21Cl2N5O2S — CID 67081042
N-[[(1S,3S,5S)-2-[5-(2,3-dichlorophenyl)-2-methyl-1,3-thiazole-4-carbonyl]-2-azabicyclo[3.1.0]hexan-3-yl]methyl]imidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 67081042) has the molecular formula C25H21Cl2N5O2S and a molecular weight of 526.45 g/mol. Its IUPAC name is N-[[(1S,3S,5S)-2-[5-(2,3-dichlorophenyl)-2-methyl-1,3-thiazole-4-carbonyl]-2-azabicyclo[3.1.0]hexan-3-yl]methyl]imidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | N-[[(1S,3S,5S)-2-[5-(2,3-dichlorophenyl)-2-methyl-1,3-thiazole-4-carbonyl]-2-azabicyclo[3.1.0]hexan-3-yl]methyl]imidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 67081042 |
| Molecular Formula | C25H21Cl2N5O2S |
| Molecular Weight | 526.45 g/mol |
| Exact Mass | 525.08 |
| IUPAC Name | N-[[(1S,3S,5S)-2-[5-(2,3-dichlorophenyl)-2-methyl-1,3-thiazole-4-carbonyl]-2-azabicyclo[3.1.0]hexan-3-yl]methyl]imidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | Cc1nc(C(=O)N2[C@H](CNC(=O)c3cnc4ccccn34)C[C@@H]3C[C@@H]32)c(-c2cccc(Cl)c2Cl)s1 |
| InChI | InChI=1S/C25H21Cl2N5O2S/c1-13-30-22(23(35-13)16-5-4-6-17(26)21(16)27)25(34)32-15(9-14-10-18(14)32)11-29-24(33)19-12-28-20-7-2-3-8-31(19)20/h2-8,12,14-15,18H,9-11H2,1H3,(H,29,33)/t14-,15+,18+/m1/s1 |
| InChIKey | JSZULGYDCJZPOF-VKJFTORMSA-N |
| XLogP | 5.11 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.45 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |