C18H16ClF4N3O5 — CID 67082158
(E)-4-[2-chloro-5-[2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-4-fluorophenoxy]-3-methoxy-N,N-dimethylbut-2-enamide (PubChem CID 67082158) has the molecular formula C18H16ClF4N3O5 and a molecular weight of 465.79 g/mol. Its IUPAC name is (E)-4-[2-chloro-5-[2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-4-fluorophenoxy]-3-methoxy-N,N-dimethylbut-2-enamide.
| Compound Name | (E)-4-[2-chloro-5-[2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-4-fluorophenoxy]-3-methoxy-N,N-dimethylbut-2-enamide |
|---|---|
| PubChem CID | 67082158 |
| Molecular Formula | C18H16ClF4N3O5 |
| Molecular Weight | 465.79 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | (E)-4-[2-chloro-5-[2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-4-fluorophenoxy]-3-methoxy-N,N-dimethylbut-2-enamide |
| SMILES | CO/C(=C/C(=O)N(C)C)COc1cc(-n2c(=O)cc(C(F)(F)F)[nH]c2=O)c(F)cc1Cl |
| InChI | InChI=1S/C18H16ClF4N3O5/c1-25(2)15(27)4-9(30-3)8-31-13-6-12(11(20)5-10(13)19)26-16(28)7-14(18(21,22)23)24-17(26)29/h4-7H,8H2,1-3H3,(H,24,29)/b9-4+ |
| InChIKey | AEUXEYLZAUWNCD-RUDMXATFSA-N |
| XLogP | 2.33 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.79 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|