About (1S,3R)-1-[4-(hydroxymethyl)phenyl]-4-pyrimidin-2-ylsulfanylbutane-1,3-diol
(1S,3R)-1-[4-(hydroxymethyl)phenyl]-4-pyrimidin-2-ylsulfanylbutane-1,3-diol (PubChem CID 6708409) has the molecular formula C15H18N2O3S
and a molecular weight of 306.39 g/mol. Its IUPAC name is (1S,3R)-1-[4-(hydroxymethyl)phenyl]-4-pyrimidin-2-ylsulfanylbutane-1,3-diol.
Molecular Properties
| Compound Name | (1S,3R)-1-[4-(hydroxymethyl)phenyl]-4-pyrimidin-2-ylsulfanylbutane-1,3-diol |
| PubChem CID | 6708409 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | (1S,3R)-1-[4-(hydroxymethyl)phenyl]-4-pyrimidin-2-ylsulfanylbutane-1,3-diol |
| SMILES | OCc1ccc([C@@H](O)C[C@@H](O)CSc2ncccn2)cc1 |
| InChI | InChI=1S/C15H18N2O3S/c18-9-11-2-4-12(5-3-11)14(20)8-13(19)10-21-15-16-6-1-7-17-15/h1-7,13-14,18-20H,8-10H2/t13-,14+/m1/s1 |
| InChIKey | LTJGPTJREYIFIV-KGLIPLIRSA-N |
| XLogP | 1.55 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (1S,3R)-1-[4-(hydroxymethyl)phenyl]-4-pyrimidin-2-ylsulfanylbutane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,3R)-1-[4-(hydroxymethyl)phenyl]-4-pyrimidin-2-ylsulfanylbutane-1,3-diol?
The IUPAC name of (1S,3R)-1-[4-(hydroxymethyl)phenyl]-4-pyrimidin-2-ylsulfanylbutane-1,3-diol (CID 6708409) is (1S,3R)-1-[4-(hydroxymethyl)phenyl]-4-pyrimidin-2-ylsulfanylbutane-1,3-diol.
What is the SMILES notation for (1S,3R)-1-[4-(hydroxymethyl)phenyl]-4-pyrimidin-2-ylsulfanylbutane-1,3-diol?
The canonical SMILES for (1S,3R)-1-[4-(hydroxymethyl)phenyl]-4-pyrimidin-2-ylsulfanylbutane-1,3-diol is OCc1ccc([C@@H](O)C[C@@H](O)CSc2ncccn2)cc1.
What is the InChIKey of (1S,3R)-1-[4-(hydroxymethyl)phenyl]-4-pyrimidin-2-ylsulfanylbutane-1,3-diol?
The InChIKey is LTJGPTJREYIFIV-KGLIPLIRSA-N. The full InChI is InChI=1S/C15H18N2O3S/c18-9-11-2-4-12(5-3-11)14(20)8-13(19)10-21-15-16-6-1-7-17-15/h1-7,13-14,18-20H,8-10H2/t13-,14+/m1/s1.
What are the key properties of (1S,3R)-1-[4-(hydroxymethyl)phenyl]-4-pyrimidin-2-ylsulfanylbutane-1,3-diol?
(1S,3R)-1-[4-(hydroxymethyl)phenyl]-4-pyrimidin-2-ylsulfanylbutane-1,3-diol has a molecular weight of 306.39 g/mol, XLogP of 1.55, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,3R)-1-[4-(hydroxymethyl)phenyl]-4-pyrimidin-2-ylsulfanylbutane-1,3-diol is sourced from PubChem (CID 6708409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).