C14H20N6O2S2 — CID 139806001
(2R,3R,4R,5R)-2,5-diamino-1,6-bis(pyrimidin-2-ylsulfanyl)hexane-3,4-diol (PubChem CID 139806001) has the molecular formula C14H20N6O2S2 and a molecular weight of 368.49 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2,5-diamino-1,6-bis(pyrimidin-2-ylsulfanyl)hexane-3,4-diol.
| Compound Name | (2R,3R,4R,5R)-2,5-diamino-1,6-bis(pyrimidin-2-ylsulfanyl)hexane-3,4-diol |
|---|---|
| PubChem CID | 139806001 |
| Molecular Formula | C14H20N6O2S2 |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | (2R,3R,4R,5R)-2,5-diamino-1,6-bis(pyrimidin-2-ylsulfanyl)hexane-3,4-diol |
| SMILES | N[C@@H](CSc1ncccn1)[C@@H](O)[C@H](O)[C@@H](N)CSc1ncccn1 |
| InChI | InChI=1S/C14H20N6O2S2/c15-9(7-23-13-17-3-1-4-18-13)11(21)12(22)10(16)8-24-14-19-5-2-6-20-14/h1-6,9-12,21-22H,7-8,15-16H2/t9-,10-,11+,12+/m0/s1 |
| InChIKey | HQRUUZCNFWYFQO-NNYUYHANSA-N |
| XLogP | -0.47 |
| TPSA | 144.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |