C22H25NO4S — CID 67084586
ethyl 3-cyclopentyl-2-[4-(pyridin-3-ylmethylsulfonyl)phenyl]prop-2-enoate (PubChem CID 67084586) has the molecular formula C22H25NO4S and a molecular weight of 399.51 g/mol. Its IUPAC name is ethyl 3-cyclopentyl-2-[4-(pyridin-3-ylmethylsulfonyl)phenyl]prop-2-enoate.
| Compound Name | ethyl 3-cyclopentyl-2-[4-(pyridin-3-ylmethylsulfonyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 67084586 |
| Molecular Formula | C22H25NO4S |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | ethyl 3-cyclopentyl-2-[4-(pyridin-3-ylmethylsulfonyl)phenyl]prop-2-enoate |
| SMILES | CCOC(=O)C(=CC1CCCC1)c1ccc(S(=O)(=O)Cc2cccnc2)cc1 |
| InChI | InChI=1S/C22H25NO4S/c1-2-27-22(24)21(14-17-6-3-4-7-17)19-9-11-20(12-10-19)28(25,26)16-18-8-5-13-23-15-18/h5,8-15,17H,2-4,6-7,16H2,1H3 |
| InChIKey | YKZXVTZSMQRLOW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|