C27H36ClN3O5 — CID 67085631
tert-butyl N-[2-[[2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoyl]amino]ethyl-methylamino]-N-ethylcarbamate (PubChem CID 67085631) has the molecular formula C27H36ClN3O5 and a molecular weight of 518.05 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoyl]amino]ethyl-methylamino]-N-ethylcarbamate.
| Compound Name | tert-butyl N-[2-[[2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoyl]amino]ethyl-methylamino]-N-ethylcarbamate |
|---|---|
| PubChem CID | 67085631 |
| Molecular Formula | C27H36ClN3O5 |
| Molecular Weight | 518.05 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | tert-butyl N-[2-[[2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoyl]amino]ethyl-methylamino]-N-ethylcarbamate |
| SMILES | CCN(C(=O)OC(C)(C)C)N(C)CCNC(=O)C(C)(C)Oc1ccc(C(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C27H36ClN3O5/c1-8-31(25(34)36-26(2,3)4)30(7)18-17-29-24(33)27(5,6)35-22-15-11-20(12-16-22)23(32)19-9-13-21(28)14-10-19/h9-16H,8,17-18H2,1-7H3,(H,29,33) |
| InChIKey | KDMIYUZTKOBSLF-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.05 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|