C20H22N2O — CID 67085837
2-[1-[4-(2,4-dimethylphenoxy)phenyl]pyrrolidin-2-yl]acetonitrile (PubChem CID 67085837) has the molecular formula C20H22N2O and a molecular weight of 306.41 g/mol. Its IUPAC name is 2-[1-[4-(2,4-dimethylphenoxy)phenyl]pyrrolidin-2-yl]acetonitrile.
| Compound Name | 2-[1-[4-(2,4-dimethylphenoxy)phenyl]pyrrolidin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 67085837 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 2-[1-[4-(2,4-dimethylphenoxy)phenyl]pyrrolidin-2-yl]acetonitrile |
| SMILES | Cc1ccc(Oc2ccc(N3CCCC3CC#N)cc2)c(C)c1 |
| InChI | InChI=1S/C20H22N2O/c1-15-5-10-20(16(2)14-15)23-19-8-6-18(7-9-19)22-13-3-4-17(22)11-12-21/h5-10,14,17H,3-4,11,13H2,1-2H3 |
| InChIKey | ARPGMPZEMUHHTL-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |