C19H22BrNO4S — CID 87262812
[1-[4-(3-bromo-2-methylphenoxy)phenyl]pyrrolidin-2-yl]methyl methanesulfonate (PubChem CID 87262812) has the molecular formula C19H22BrNO4S and a molecular weight of 440.36 g/mol. Its IUPAC name is [1-[4-(3-bromo-2-methylphenoxy)phenyl]pyrrolidin-2-yl]methyl methanesulfonate.
| Compound Name | [1-[4-(3-bromo-2-methylphenoxy)phenyl]pyrrolidin-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 87262812 |
| Molecular Formula | C19H22BrNO4S |
| Molecular Weight | 440.36 g/mol |
| Exact Mass | 439.05 |
| IUPAC Name | [1-[4-(3-bromo-2-methylphenoxy)phenyl]pyrrolidin-2-yl]methyl methanesulfonate |
| SMILES | Cc1c(Br)cccc1Oc1ccc(N2CCCC2COS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C19H22BrNO4S/c1-14-18(20)6-3-7-19(14)25-17-10-8-15(9-11-17)21-12-4-5-16(21)13-24-26(2,22)23/h3,6-11,16H,4-5,12-13H2,1-2H3 |
| InChIKey | TUXUBJQQHORWHH-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.36 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|