C31H37Cl2FN4O5S — CID 67089045
(2S)-2-acetamido-6-[(2-fluorophenyl)sulfonylamino]-N-[6-methoxy-1-(pyridin-3-ylmethyl)-4H-naphthalen-1-yl]hexanamide;dihydrochloride (PubChem CID 67089045) has the molecular formula C31H37Cl2FN4O5S and a molecular weight of 667.63 g/mol. Its IUPAC name is (2S)-2-acetamido-6-[(2-fluorophenyl)sulfonylamino]-N-[6-methoxy-1-(pyridin-3-ylmethyl)-4H-naphthalen-1-yl]hexanamide;dihydrochloride.
| Compound Name | (2S)-2-acetamido-6-[(2-fluorophenyl)sulfonylamino]-N-[6-methoxy-1-(pyridin-3-ylmethyl)-4H-naphthalen-1-yl]hexanamide;dihydrochloride |
|---|---|
| PubChem CID | 67089045 |
| Molecular Formula | C31H37Cl2FN4O5S |
| Molecular Weight | 667.63 g/mol |
| Exact Mass | 666.18 |
| IUPAC Name | (2S)-2-acetamido-6-[(2-fluorophenyl)sulfonylamino]-N-[6-methoxy-1-(pyridin-3-ylmethyl)-4H-naphthalen-1-yl]hexanamide;dihydrochloride |
| SMILES | COc1ccc2c(c1)CC=CC2(Cc1cccnc1)NC(=O)[C@H](CCCCNS(=O)(=O)c1ccccc1F)NC(C)=O.Cl.Cl |
| InChI | InChI=1S/C31H35FN4O5S.2ClH/c1-22(37)35-28(12-5-6-18-34-42(39,40)29-13-4-3-11-27(29)32)30(38)36-31(20-23-9-8-17-33-21-23)16-7-10-24-19-25(41-2)14-15-26(24)31;;/h3-4,7-9,11,13-17,19,21,28,34H,5-6,10,12,18,20H2,1-2H3,(H,35,37)(H,36,38);2*1H/t28-,31?;;/m0../s1 |
| InChIKey | IXYIWYTXJCDRCG-PGCJBEDKSA-N |
| XLogP | 4.39 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.63 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|