C23H22ClN3O4 — CID 67095306
2-(5-chloro-2H-indazol-3-yl)-2-ethyl-4-(1H-indol-3-yl)hexanedioic acid (PubChem CID 67095306) has the molecular formula C23H22ClN3O4 and a molecular weight of 439.90 g/mol. Its IUPAC name is 2-(5-chloro-2H-indazol-3-yl)-2-ethyl-4-(1H-indol-3-yl)hexanedioic acid.
| Compound Name | 2-(5-chloro-2H-indazol-3-yl)-2-ethyl-4-(1H-indol-3-yl)hexanedioic acid |
|---|---|
| PubChem CID | 67095306 |
| Molecular Formula | C23H22ClN3O4 |
| Molecular Weight | 439.90 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 2-(5-chloro-2H-indazol-3-yl)-2-ethyl-4-(1H-indol-3-yl)hexanedioic acid |
| SMILES | CCC(CC(CC(=O)O)c1c[nH]c2ccccc12)(C(=O)O)c1[nH]nc2ccc(Cl)cc12 |
| InChI | InChI=1S/C23H22ClN3O4/c1-2-23(22(30)31,21-16-10-14(24)7-8-19(16)26-27-21)11-13(9-20(28)29)17-12-25-18-6-4-3-5-15(17)18/h3-8,10,12-13,25H,2,9,11H2,1H3,(H,26,27)(H,28,29)(H,30,31) |
| InChIKey | GGRNEGQMAQQCCN-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 119.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.90 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |