C21H23BrN4O4S — CID 67100549
1-[(5-bromothiophene-2-carbonyl)amino]-1-(cyclopropylmethyl)-3-[3-methyl-4-(3-oxomorpholin-4-yl)phenyl]urea (PubChem CID 67100549) has the molecular formula C21H23BrN4O4S and a molecular weight of 507.41 g/mol. Its IUPAC name is 1-[(5-bromothiophene-2-carbonyl)amino]-1-(cyclopropylmethyl)-3-[3-methyl-4-(3-oxomorpholin-4-yl)phenyl]urea.
| Compound Name | 1-[(5-bromothiophene-2-carbonyl)amino]-1-(cyclopropylmethyl)-3-[3-methyl-4-(3-oxomorpholin-4-yl)phenyl]urea |
|---|---|
| PubChem CID | 67100549 |
| Molecular Formula | C21H23BrN4O4S |
| Molecular Weight | 507.41 g/mol |
| Exact Mass | 506.06 |
| IUPAC Name | 1-[(5-bromothiophene-2-carbonyl)amino]-1-(cyclopropylmethyl)-3-[3-methyl-4-(3-oxomorpholin-4-yl)phenyl]urea |
| SMILES | Cc1cc(NC(=O)N(CC2CC2)NC(=O)c2ccc(Br)s2)ccc1N1CCOCC1=O |
| InChI | InChI=1S/C21H23BrN4O4S/c1-13-10-15(4-5-16(13)25-8-9-30-12-19(25)27)23-21(29)26(11-14-2-3-14)24-20(28)17-6-7-18(22)31-17/h4-7,10,14H,2-3,8-9,11-12H2,1H3,(H,23,29)(H,24,28) |
| InChIKey | FJCFUDRSMPLUBO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|