C22H19N3O — CID 671056
1-[(3,5-dimethyl-1-phenylpyrazol-4-yl)iminomethyl]naphthalen-2-ol (PubChem CID 671056) has the molecular formula C22H19N3O and a molecular weight of 341.41 g/mol. Its IUPAC name is 1-[(3,5-dimethyl-1-phenylpyrazol-4-yl)iminomethyl]naphthalen-2-ol.
| Compound Name | 1-[(3,5-dimethyl-1-phenylpyrazol-4-yl)iminomethyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 671056 |
| Molecular Formula | C22H19N3O |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 1-[(3,5-dimethyl-1-phenylpyrazol-4-yl)iminomethyl]naphthalen-2-ol |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1/N=C/c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C22H19N3O/c1-15-22(16(2)25(24-15)18-9-4-3-5-10-18)23-14-20-19-11-7-6-8-17(19)12-13-21(20)26/h3-14,26H,1-2H3/b23-14+ |
| InChIKey | CUFROPAPALHYCN-OEAKJJBVSA-N |
| XLogP | 5.10 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|